Difference between revisions of "Ec-05 005680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-3 PWY4FS-3] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-3 PWY4FS-3] ==
* smiles:
+
* taxonomic range:
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
+
 
* common name:
 
* common name:
** α,ω-9Z-octadecenedioate
+
** phosphatidylcholine biosynthesis III
* molecular weight:
+
** 310.433   
+
 
* Synonym(s):
 
* Synonym(s):
** α,ω-9Z-octadecenedioic acid
 
** 1,18-9Z-octadecenedioic acid
 
** octadecenedioate
 
** 18-carboxyl oleate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-16418]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2.1.1.71-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-08_004940]]
 +
*** [[Ec-18_002350]]
 +
*** [[Ec-24_001260]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN4FS-2]]
 +
** 3 associated gene(s):
 +
*** [[Ec-18_002350]]
 +
*** [[Ec-08_004940]]
 +
*** [[Ec-24_001260]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.103-RXN 2.1.1.103-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.57-RXN 2.7.7.57-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-1 RXN4FS-1]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
+
{{#set: common name=phosphatidylcholine biosynthesis III}}
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
+
{{#set: reaction found=2}}
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
+
{{#set: total reaction=5}}
{{#set: common name=α,ω-9Z-octadecenedioate}}
+
{{#set: completion rate=40.0}}
{{#set: molecular weight=310.433    }}
+
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
+
{{#set: consumed by=RXN-16418}}
+

Revision as of 22:15, 17 March 2018

Pathway PWY4FS-3

  • taxonomic range:
  • common name:
    • phosphatidylcholine biosynthesis III
  • Synonym(s):

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links