Difference between revisions of "Ec-26 002980"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] == * smiles: ** C([O-])(=O)C(O)=CC1(C=CC=CC=1) * inchi...") |
(Created page with "Category:Gene == Gene Ec-08_003600 == * left end position: ** 3427267 * transcription direction: ** NEGATIVE * right end position: ** 3433623 * centisome position: ** 51.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_003600 == |
− | * | + | * left end position: |
− | ** | + | ** 3427267 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3433623 |
− | * | + | * centisome position: |
− | ** | + | ** 51.175648 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0342_0002 | ||
+ | ** Esi0342_0002 | ||
− | == | + | == Reactions associated == |
− | + | * [[RXN-15556]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3427267}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3433623}} | |
− | + | {{#set: centisome position=51.175648 }} | |
− | + | {{#set: common name=Esi_0342_0002|Esi0342_0002}} | |
− | + | {{#set: reaction associated=RXN-15556}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:15, 17 March 2018
Gene Ec-08_003600
- left end position:
- 3427267
- transcription direction:
- NEGATIVE
- right end position:
- 3433623
- centisome position:
- 51.175648
- Synonym(s):
- Esi_0342_0002
- Esi0342_0002
Reactions associated
- RXN-15556
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome