Difference between revisions of "DISULFOXRED-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-00_010030 == * left end position: ** 16928311 * transcription direction: ** POSITIVE * right end position: ** 16932332 * centisome position: ** 89...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_010030 == |
− | * | + | * left end position: |
− | ** | + | ** 16928311 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 16932332 |
− | * | + | * centisome position: |
− | ** | + | ** 89.34829 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0772_0002 | ||
+ | ** Esi0772_0002 | ||
+ | ** CAT | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[CATAL-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***ec-number |
− | * [[ | + | * [[PEROXID-RXN]] |
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-14189]] | ||
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | * [[RXN-14240]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-15288]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-17352]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-8635]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-8667]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN66-1]] | ||
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7214]] | ||
+ | * [[PWY-7445]] | ||
+ | * [[PWY66-162]] | ||
+ | * [[DETOX1-PWY]] | ||
+ | * [[PWY-6824]] | ||
+ | * [[DETOX1-PWY-1]] | ||
+ | * [[PWY-5469]] | ||
+ | * [[PWY-5506]] | ||
+ | * [[PWY-5466]] | ||
+ | * [[PWY-5461]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=16928311}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=16932332}} | |
− | + | {{#set: centisome position=89.34829 }} | |
− | + | {{#set: common name=Esi_0772_0002|Esi0772_0002|CAT}} | |
− | + | {{#set: reaction associated=CATAL-RXN|PEROXID-RXN|RXN-14189|RXN-14240|RXN-15288|RXN-17352|RXN-8635|RXN-8667|RXN66-1}} | |
− | + | {{#set: pathway associated=PWY-7214|PWY-7445|PWY66-162|DETOX1-PWY|PWY-6824|DETOX1-PWY-1|PWY-5469|PWY-5506|PWY-5466|PWY-5461}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:16, 17 March 2018
Gene Ec-00_010030
- left end position:
- 16928311
- transcription direction:
- POSITIVE
- right end position:
- 16932332
- centisome position:
- 89.34829
- Synonym(s):
- Esi_0772_0002
- Esi0772_0002
- CAT
Reactions associated
- CATAL-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- PEROXID-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-14189
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-14240
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-15288
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-17352
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-8635
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-8667
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN66-1
- esiliculosus_genome
- ec-number
- esiliculosus_genome