Difference between revisions of "RXN-10059"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6578 PWY-6578] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6578 PWY-6578] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J
+
 
* common name:
 
* common name:
** pristanoyl-CoA
+
** 8-amino-7-oxononanoate biosynthesis III
* molecular weight:
+
** 1043.995   
+
 
* Synonym(s):
 
* Synonym(s):
** 2,6,10,14-tetramethylpentadecanoyl-CoA
+
** 7-keto-8-aminopelargonate biosynthesis III
** 2,6,10,14-tetramethylpentadecanoyl-coenzyme A
+
** pristanoyl-coenzyme A
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN66-484]]
+
* [[7KAPSYN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-04_002200]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=6-CARBOXYHEXANOATE--COA-LIGASE-RXN 6-CARBOXYHEXANOATE--COA-LIGASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289196 86289196]
+
{{#set: common name=8-amino-7-oxononanoate biosynthesis III}}
* CHEBI:
+
{{#set: common name=7-keto-8-aminopelargonate biosynthesis III}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77250 77250]
+
{{#set: reaction found=1}}
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: total reaction=2}}
{{#set: inchi key=InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J}}
+
{{#set: completion rate=50.0}}
{{#set: common name=pristanoyl-CoA}}
+
{{#set: molecular weight=1043.995    }}
+
{{#set: common name=2,6,10,14-tetramethylpentadecanoyl-CoA|2,6,10,14-tetramethylpentadecanoyl-coenzyme A|pristanoyl-coenzyme A}}
+
{{#set: produced by=RXN66-484}}
+

Revision as of 21:17, 17 March 2018

Pathway PWY-6578

  • taxonomic range:
  • common name:
    • 8-amino-7-oxononanoate biosynthesis III
  • Synonym(s):
    • 7-keto-8-aminopelargonate biosynthesis III

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links