Difference between revisions of "Ec-06 000980"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
−
* inchi key:
+
−
** InChIKey=BHVZCCKRRPYXCV-MGNVXPIMSA-J
+
 
* common name:
 
* common name:
−
** ricinoleoyl-CoA
+
** melatonin degradation I
−
* molecular weight:
+
−
** 1043.952   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 12-hydroxy-9-octadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-11056]]
−
* [[RXN-16151]]
+
** 3 associated gene(s):
 +
*** [[Ec-26_003280]]
 +
*** [[Ec-00_001320]]
 +
*** [[Ec-01_010880]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11057]]
 +
** 3 associated gene(s):
 +
*** [[Ec-00_001320]]
 +
*** [[Ec-01_010880]]
 +
*** [[Ec-26_003280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11058]]
 +
** 5 associated gene(s):
 +
*** [[Ec-00_005410]]
 +
*** [[Ec-06_007300]]
 +
*** [[Ec-26_003630]]
 +
*** [[Ec-06_007310]]
 +
*** [[Ec-06_007320]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11059]]
 +
** 5 associated gene(s):
 +
*** [[Ec-26_003630]]
 +
*** [[Ec-06_007320]]
 +
*** [[Ec-06_007310]]
 +
*** [[Ec-00_005410]]
 +
*** [[Ec-06_007300]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11060 RXN-11060]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-MAP:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658767 90658767]
+
** [http://www.genome.jp/dbget-bin/www_bget?map00380 map00380]
−
{{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: taxonomic range=TAX-7742}}
−
{{#set: inchi key=InChIKey=BHVZCCKRRPYXCV-MGNVXPIMSA-J}}
+
{{#set: common name=melatonin degradation I}}
−
{{#set: common name=ricinoleoyl-CoA}}
+
{{#set: reaction found=4}}
−
{{#set: molecular weight=1043.952    }}
+
{{#set: total reaction=5}}
−
{{#set: common name=12-hydroxy-9-octadecenoyl-CoA}}
+
{{#set: completion rate=80.0}}
−
{{#set: consumed or produced by=RXN-16151}}
+

Revision as of 21:17, 17 March 2018

Pathway PWY-6398

  • taxonomic range:
  • common name:
    • melatonin degradation I
  • Synonym(s):

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_000980&oldid=12412"