Difference between revisions of "PWY-7614"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-237 CPD-237] == * smiles: ** C1(=C(CC(N)=O)C2(=CC=CC=C(N1)2)) * inchi key: ** InChIKey=ZOAM...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-122...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** adenosylcobalamin salvage from cobinamide I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** vitamin B12 biosynthesis |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''6''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[BTUR2-RXN]] |
| − | == | + | ** 1 associated gene(s): |
| + | *** [[Ec-06_010830]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=COBALAMIN5PSYN-RXN COBALAMIN5PSYN-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDEKIN-RXN COBINAMIDEKIN-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8770 RXN-8770] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY] | |
| − | + | {{#set: taxonomic range=TAX-1224}} | |
| − | ** [http:// | + | {{#set: common name=adenosylcobalamin salvage from cobinamide I}} |
| − | + | {{#set: common name=vitamin B12 biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=17.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 21:18, 17 March 2018
Pathway COBALSYN-PWY
- taxonomic range:
- common name:
- adenosylcobalamin salvage from cobinamide I
- Synonym(s):
- vitamin B12 biosynthesis
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- BTUR2-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
