Difference between revisions of "Ec-12 006780"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNASE-III-MRNA-PROCESSING-SUBSTRATE RNASE-III-MRNA-PROCESSING-SUBSTRATE] == * common name: ** R...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNASE-III-MRNA-PROCESSING-SUBSTRATE RNASE-III-MRNA-PROCESSING-SUBSTRATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] ==
 +
* smiles:
 +
** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
 +
* inchi key:
 +
** InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
 
* common name:
 
* common name:
** RNase III mRNA processing substrate
+
** 9-mercaptodethiobiotin
 +
* molecular weight:
 +
** 245.316   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9-mercaptodesthiobiotin
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.26.3-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-17473]]
 +
* [[RXN-17472]]
 
== External links  ==
 
== External links  ==
{{#set: common name=RNase III mRNA processing substrate}}
+
* PUBCHEM:
{{#set: consumed by=3.1.26.3-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244092 25244092]
 +
{{#set: smiles=C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])}}
 +
{{#set: inchi key=InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M}}
 +
{{#set: common name=9-mercaptodethiobiotin}}
 +
{{#set: molecular weight=245.316    }}
 +
{{#set: common name=9-mercaptodesthiobiotin}}
 +
{{#set: reversible reaction associated=RXN-17473|RXN-17472}}

Revision as of 21:18, 17 March 2018

Metabolite CPD-5662

  • smiles:
    • C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
  • inchi key:
    • InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
  • common name:
    • 9-mercaptodethiobiotin
  • molecular weight:
    • 245.316
  • Synonym(s):
    • 9-mercaptodesthiobiotin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])" cannot be used as a page name in this wiki.