Difference between revisions of "INDOXYL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5137 PWY-5137] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5137 PWY-5137] ==
−
* smiles:
+
* taxonomic range:
−
** C([O-])(=O)CC=CC=C(O)C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
** InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
−
** (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate
+
** fatty acid β-oxidation III (unsaturated, odd number)
−
* molecular weight:
+
−
** 170.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate
 
−
** HHDD
 
−
** (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''1''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[ENOYL-COA-DELTA-ISOM-RXN]]
−
* [[RXN1K-87]]
+
** 1 associated gene(s):
 +
*** [[Ec-20_003150]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54715389 54715389]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5137 PWY-5137]
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.chemspider.com/Chemical-Structure.11531600.html 11531600]
+
{{#set: taxonomic range=TAX-2157}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78626 78626]
+
{{#set: common name=fatty acid β-oxidation III (unsaturated, odd number)}}
−
* LIGAND-CPD:
+
{{#set: reaction found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05600 C05600]
+
{{#set: total reaction=1}}
−
{{#set: smiles=C([O-])(=O)CC=CC=C(O)C(=O)[O-]}}
+
{{#set: completion rate=100.0}}
−
{{#set: inchi key=InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L}}
+
−
{{#set: common name=(2Z,4Z)-2-hydroxyhepta-2,4-dienedioate}}
+
−
{{#set: molecular weight=170.121    }}
+
−
{{#set: common name=(2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate|HHDD|(2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate}}
+
−
{{#set: consumed or produced by=RXN1K-87}}
+

Revision as of 21:19, 17 March 2018

Pathway PWY-5137

  • taxonomic range:
  • common name:
    • fatty acid β-oxidation III (unsaturated, odd number)
  • Synonym(s):

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=INDOXYL&oldid=12527"