Difference between revisions of "TransportSeed COB-I-ALAMIN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_000950 == * left end position: ** 905822 * transcription direction: ** NEGATIVE * right end position: ** 916139 * centisome position: ** 17.566...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == |
− | * | + | * smiles: |
− | ** | + | ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N |
− | * | + | * common name: |
− | ** | + | ** amino-parathion |
− | * | + | * molecular weight: |
− | ** | + | ** 261.275 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[AMINOPARATHION-PHOSPHATASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=220 220] | |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06605 C06605] |
− | {{#set: common name= | + | * HMDB : HMDB01504 |
− | {{#set: | + | {{#set: smiles=CCOP(OC1(C=CC(=CC=1)N))(OCC)=S}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N}} |
+ | {{#set: common name=amino-parathion}} | ||
+ | {{#set: molecular weight=261.275 }} | ||
+ | {{#set: consumed by=AMINOPARATHION-PHOSPHATASE-RXN}} |
Revision as of 21:19, 17 March 2018
Contents
Metabolite AMINO-PARATHION
- smiles:
- CCOP(OC1(C=CC(=CC=1)N))(OCC)=S
- inchi key:
- InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N
- common name:
- amino-parathion
- molecular weight:
- 261.275
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links