Difference between revisions of "PWY-7118"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Phosphotyrosine MAP-Kinase-L-Phosphotyrosine] == * common name: ** a [mitogen-acti...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Phosphotyrosine MAP-Kinase-L-Phosphotyrosine] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [mitogen-activated protein kinase] L-tyrosine phosphate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-16317]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [mitogen-activated protein kinase] L-tyrosine phosphate}} | |
| − | + | {{#set: reversible reaction associated=RXN-16317}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 21:20, 17 March 2018
Contents
Metabolite MAP-Kinase-L-Phosphotyrosine
- common name:
- a [mitogen-activated protein kinase] L-tyrosine phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [mitogen-activated protein kinase] L-tyrosine phosphate" cannot be used as a page name in this wiki.
