Difference between revisions of "Phospholipid-Olefinic-Fatty-Acids"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3) * inchi k...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == |
− | * | + | * smiles: |
− | ** [ | + | ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SUYJZKRQHBQNCA-LSDHHAIUSA-M |
* common name: | * common name: | ||
− | ** | + | ** (+)-pinobanksin |
+ | * molecular weight: | ||
+ | ** 271.249 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (2R,3R)-pinobanksin | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-7648]] | |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | == Reaction(s) | + | |
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C09826 C09826] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28103 28103] |
− | {{#set: | + | * METABOLIGHTS : MTBLC28103 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200970 25200970] |
− | {{#set: | + | * HMDB : HMDB37506 |
− | {{#set: | + | {{#set: smiles=C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3)}} |
+ | {{#set: inchi key=InChIKey=SUYJZKRQHBQNCA-LSDHHAIUSA-M}} | ||
+ | {{#set: common name=(+)-pinobanksin}} | ||
+ | {{#set: molecular weight=271.249 }} | ||
+ | {{#set: common name=(2R,3R)-pinobanksin}} | ||
+ | {{#set: produced by=RXN-7648}} |
Revision as of 21:20, 17 March 2018
Contents
Metabolite CPD-6992
- smiles:
- C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3)
- inchi key:
- InChIKey=SUYJZKRQHBQNCA-LSDHHAIUSA-M
- common name:
- (+)-pinobanksin
- molecular weight:
- 271.249
- Synonym(s):
- (2R,3R)-pinobanksin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2O)=O)O)[O-])))=CC=3)" cannot be used as a page name in this wiki.