Difference between revisions of "PWY-7197"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-10_006100 == * left end position: ** 6189815 * transcription direction: ** NEGATIVE * right end position: ** 6196058 * centisome position: ** 95.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7)))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N |
− | * | + | * common name: |
− | ** | + | ** maltoheptaose |
− | * | + | * molecular weight: |
− | ** | + | ** 1153.009 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14283]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?G00689 G00689] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61954 61954] |
− | {{#set: | + | * METABOLIGHTS : MTBLC61954 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13908996 13908996] | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))}} | ||
+ | {{#set: inchi key=InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N}} | ||
+ | {{#set: common name=maltoheptaose}} | ||
+ | {{#set: molecular weight=1153.009 }} | ||
+ | {{#set: consumed by=RXN-14283}} |
Revision as of 21:20, 17 March 2018
Contents
Metabolite CPD0-1133
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
- inchi key:
- InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
- common name:
- maltoheptaose
- molecular weight:
- 1153.009
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links