Difference between revisions of "PWY-7344"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * inc...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C |
| + | * inchi key: | ||
| + | ** InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** diprenylphlorisovalerophenone |
| + | * molecular weight: | ||
| + | ** 345.458 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** deoxyhumulone | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[RXN- | + | * [[RXN-7810]] |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203000 25203000] |
| − | {{#set: | + | {{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=diprenylphlorisovalerophenone}} |
| + | {{#set: molecular weight=345.458 }} | ||
| + | {{#set: common name=deoxyhumulone}} | ||
| + | {{#set: produced by=RXN-7810}} | ||
Revision as of 21:20, 17 March 2018
Contents
Metabolite CPD-7105
- smiles:
- CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
- inchi key:
- InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
- common name:
- diprenylphlorisovalerophenone
- molecular weight:
- 345.458
- Synonym(s):
- deoxyhumulone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C" cannot be used as a page name in this wiki.
