Difference between revisions of "RXN-8759"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_003910 == * left end position: ** 3280609 * transcription direction: ** NEGATIVE * right end position: ** 3285067 * centisome position: ** 31.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J |
− | * | + | * common name: |
− | ** | + | ** sinapoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 969.7 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** sinapinoyl-CoA |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10919]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-1124]] |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229225 44229225] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57393 57393] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: reaction associated= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00411 C00411] |
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J}} | ||
+ | {{#set: common name=sinapoyl-CoA}} | ||
+ | {{#set: molecular weight=969.7 }} | ||
+ | {{#set: common name=sinapinoyl-CoA}} | ||
+ | {{#set: produced by=RXN-10919}} | ||
+ | {{#set: reversible reaction associated=RXN-1124}} |
Revision as of 21:21, 17 March 2018
Contents
Metabolite SINAPOYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J
- common name:
- sinapoyl-CoA
- molecular weight:
- 969.7
- Synonym(s):
- sinapinoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.