Difference between revisions of "PWY-6168"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == * smiles: ** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6168 PWY-6168] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6168 PWY-6168] ==
* smiles:
+
* taxonomic range:
** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J
+
 
* common name:
 
* common name:
** 3-hydroxy-5-methylhex-4-enoyl-CoA
+
** flavin biosynthesis III (fungi)
* molecular weight:
+
** 889.657   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''6''' reactions found over '''9''' reactions in the full pathway
* [[RXN-11919]]
+
* [[DIOHBUTANONEPSYN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-27_004040]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[FADSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_006670]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GTP-CYCLOHYDRO-II-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-27_004040]]
 +
*** [[Ec-02_005710]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[LUMAZINESYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002140]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RIBOFLAVIN-SYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-00_004570]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RIBOFLAVINKIN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-14_005260]]
 +
*** [[Ec-10_002950]]
 +
*** [[Ec-04_004280]]
 +
*** [[Ec-04_001490]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RIBOPHOSPHAT-RXN RIBOPHOSPHAT-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10057 RXN-10057]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10058 RXN-10058]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986102 50986102]
+
{{#set: common name=flavin biosynthesis III (fungi)}}
* LIGAND-CPD:
+
{{#set: reaction found=6}}
** [http://www.genome.jp/dbget-bin/www_bget?C16469 C16469]
+
{{#set: total reaction=9}}
* HMDB : HMDB60373
+
{{#set: completion rate=67.0}}
{{#set: smiles=CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J}}
+
{{#set: common name=3-hydroxy-5-methylhex-4-enoyl-CoA}}
+
{{#set: molecular weight=889.657    }}
+
{{#set: produced by=RXN-11919}}
+

Revision as of 21:21, 17 March 2018

Pathway PWY-6168

  • taxonomic range:
  • common name:
    • flavin biosynthesis III (fungi)
  • Synonym(s):

Reaction(s) found

6 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links