Difference between revisions of "Ec-16 002230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * inchi key: ** InChIK...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cis-D9-hexadecenoyl-ACPs 3-oxo-cis-D9-hexadecenoyl-ACPs] == * common name: ** a 3-oxo-cis...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cis-D9-hexadecenoyl-ACPs 3-oxo-cis-D9-hexadecenoyl-ACPs] ==
−
* smiles:
+
−
** C1(C(=O)NC(=O)NC(C(=O)[O-])1)
+
−
* inchi key:
+
−
** InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M
+
 
* common name:
 
* common name:
−
** (S)-dihydroorotate
+
** a 3-oxo-cis-Δ9-hexadecenoyl-[acp]
−
* molecular weight:
+
−
** 157.105   
+
 
* Synonym(s):
 
* Synonym(s):
−
** dihydro-L-orotate
+
** a 3-oxo-cis-&DElta;9-hexadecenoyl-[acyl-carrier-protein]
−
** (S)-4,5-dihydroorotate
+
−
** (S)-4,5-dihydroorotic acid
+
−
** (S)-hydroorotic acid
+
−
** (S)-di-H-orotate
+
−
** L-dihydroorotate
+
−
** 4,5-dihydro-L-orotate
+
−
** L-4,5-dihydroorotate
+
−
** (S)-4-pyrimidinecarboxylic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-6491]]
+
* [[RXN-10659]]
−
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+
−
* [[RXN0-6554]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN0-6490]]
+
* [[RXN-10658]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[DIHYDROOROT-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 5988-19-2
+
{{#set: common name=a 3-oxo-cis-Δ9-hexadecenoyl-[acp]}}
−
* CAS : 155-54-4
+
{{#set: common name=a 3-oxo-cis-&DElta;9-hexadecenoyl-[acyl-carrier-protein]}}
−
* BIGG : 34662
+
{{#set: consumed by=RXN-10659}}
−
* PUBCHEM:
+
{{#set: produced by=RXN-10658}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460289 5460289]
+
−
* HMDB : HMDB00528
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00337 C00337]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573876.html 4573876]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30864 30864]
+
−
* METABOLIGHTS : MTBLC30864
+
−
{{#set: smiles=C1(C(=O)NC(=O)NC(C(=O)[O-])1)}}
+
−
{{#set: inchi key=InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M}}
+
−
{{#set: common name=(S)-dihydroorotate}}
+
−
{{#set: molecular weight=157.105    }}
+
−
{{#set: common name=dihydro-L-orotate|(S)-4,5-dihydroorotate|(S)-4,5-dihydroorotic acid|(S)-hydroorotic acid|(S)-di-H-orotate|L-dihydroorotate|4,5-dihydro-L-orotate|L-4,5-dihydroorotate|(S)-4-pyrimidinecarboxylic acid}}
+
−
{{#set: consumed by=RXN0-6491|DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN0-6554}}
+
−
{{#set: produced by=RXN0-6490}}
+
−
{{#set: consumed or produced by=DIHYDROOROT-RXN}}
+

Revision as of 22:21, 17 March 2018

Metabolite 3-oxo-cis-D9-hexadecenoyl-ACPs

  • common name:
    • a 3-oxo-cis-Δ9-hexadecenoyl-[acp]
  • Synonym(s):
    • a 3-oxo-cis-&DElta;9-hexadecenoyl-[acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-cis-Δ9-hexadecenoyl-[acp" cannot be used as a page name in this wiki.
"a 3-oxo-cis-&DElta;9-hexadecenoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-16_002230&oldid=12708"