Difference between revisions of "CPD-14281"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5177 PWY-5177] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5177 PWY-5177] ==
* smiles:
+
* taxonomic range:
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** 4-trans-undecenoyl-CoA
+
** glutaryl-CoA degradation
* molecular weight:
+
** 929.765   
+
 
* Synonym(s):
 
* Synonym(s):
** 4E-undecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14789]]
+
'''3''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-26_003940]]
 +
*** [[Ec-24_000870]]
 +
*** [[Ec-22_002850]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-11662]]
 +
** 2 associated gene(s):
 +
*** [[Ec-19_005290]]
 +
*** [[Ec-14_006530]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-11667]]
 +
** 2 associated gene(s):
 +
*** [[Ec-17_000320]]
 +
*** [[Ec-14_006530]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLUTACONYL-COA-DECARBOXYLASE-RXN GLUTACONYL-COA-DECARBOXYLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA-DEHYDROG-RXN GLUTARYL-COA-DEHYDROG-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658640 90658640]
+
{{#set: taxonomic range=TAX-4751}}
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J}}
+
{{#set: common name=glutaryl-CoA degradation}}
{{#set: common name=4-trans-undecenoyl-CoA}}
+
{{#set: reaction found=3}}
{{#set: molecular weight=929.765    }}
+
{{#set: total reaction=5}}
{{#set: common name=4E-undecenoyl-CoA}}
+
{{#set: completion rate=60.0}}
{{#set: consumed by=RXN-14789}}
+

Revision as of 21:22, 17 March 2018

Pathway PWY-5177

Reaction(s) found

3 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links