Difference between revisions of "CREATINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] == * smiles: ** CN2(C=NC1(=C(C(NC(N(C)1)=O)=O)2)) *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == * smiles: ** CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=BXIPALATIYNHJN-ZMHDXICWSA-J |
* common name: | * common name: | ||
| − | ** | + | ** 3-methylcrotonyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 845.604 |
* Synonym(s): | * Synonym(s): | ||
| − | ** 3 | + | ** β-methylcrotonoyl-CoA |
| + | ** 3-methylbut-2-enoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-2301]] | ||
| + | * [[RXN-11921]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14264]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03069 C03069] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57344 57344] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC57344 |
| − | {{#set: smiles= | + | * PUBCHEM: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266575 45266575] |
| − | {{#set: common name= | + | * HMDB : HMDB01493 |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}} |
| − | {{#set: common name=3 | + | {{#set: inchi key=InChIKey=BXIPALATIYNHJN-ZMHDXICWSA-J}} |
| − | {{#set: consumed by=RXN- | + | {{#set: common name=3-methylcrotonyl-CoA}} |
| + | {{#set: molecular weight=845.604 }} | ||
| + | {{#set: common name=β-methylcrotonoyl-CoA|3-methylbut-2-enoyl-CoA}} | ||
| + | {{#set: consumed by=METHYLCROTONYL-COA-CARBOXYLASE-RXN}} | ||
| + | {{#set: produced by=RXN0-2301|RXN-11921}} | ||
| + | {{#set: reversible reaction associated=RXN-14264}} | ||
Revision as of 21:22, 17 March 2018
Contents
Metabolite 3-METHYL-CROTONYL-COA
- smiles:
- CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
- inchi key:
- InChIKey=BXIPALATIYNHJN-ZMHDXICWSA-J
- common name:
- 3-methylcrotonyl-CoA
- molecular weight:
- 845.604
- Synonym(s):
- β-methylcrotonoyl-CoA
- 3-methylbut-2-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C" cannot be used as a page name in this wiki.
