Difference between revisions of "CPD-17347"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17797 RXN-17797] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrog...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17797 RXN-17797] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA
+
** 6-phosphogluconate dehydrogenase, C-terminal-like
−
* inchi key:
+
** 3-hydroxyacyl-CoA dehydrogenase
−
** InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
−
** 1069.99   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-hydroxy-20:2Δ11,14
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16096]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-19150]][c] '''=>''' 1 [[CPD-19151]][c]
−
* [[RXN-16095]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 (2E,5Z)-dodecenoyl-CoA[c] '''=>''' 1 (S)-3-hydroxy-(5Z)-dodecenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-19_005290]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
* [[Ec-14_006530]]
 +
** ESILICULOSUS_GENOME
 +
***GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193805 72193805]
+
{{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}}
−
* CHEBI:
+
{{#set: common name=3-hydroxyacyl-CoA dehydrogenase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76408 76408]
+
{{#set: ec number=EC-1.1.1.35}}
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=Ec-19_005290|Ec-14_006530}}
−
{{#set: common name=(3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=1069.99    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=(3R)-hydroxy-20:2Δ11,14}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=RXN-16096}}
+
−
{{#set: produced by=RXN-16095}}
+

Revision as of 21:22, 17 March 2018

Reaction RXN-17797

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 6-phosphogluconate dehydrogenase, C-terminal-like
    • 3-hydroxyacyl-CoA dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 (2E,5Z)-dodecenoyl-CoA[c] => 1 (S)-3-hydroxy-(5Z)-dodecenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-17347&oldid=12736"