Difference between revisions of "Ec-10 000640"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINASE-RXN CREATINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Creatinase/Aminop...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CREATINASE-RXN CREATINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Creatinase/Aminopeptidase P, N-terminal |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.3.3 EC-3.5.3.3] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[CREATINE]][c] '''=>''' 1 [[SARCOSINE]][c] '''+''' 1 [[UREA]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 creatine[c] '''=>''' 1 sarcosine[c] '''+''' 1 urea[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Ec-06_008580]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[CRNFORCAT-PWY]], creatinine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=CRNFORCAT-PWY CRNFORCAT-PWY] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22456 22456] |
− | + | * LIGAND-RXN: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01566 R01566] |
− | {{#set: common name= | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P38487 P38487] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P19213 P19213] |
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Creatinase/Aminopeptidase P, N-terminal}} | ||
+ | {{#set: ec number=EC-3.5.3.3}} | ||
+ | {{#set: gene associated=Ec-06_008580}} | ||
+ | {{#set: in pathway=CRNFORCAT-PWY}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 21:22, 17 March 2018
Contents
Reaction CREATINASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Creatinase/Aminopeptidase P, N-terminal
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 1 creatine[c] => 1 sarcosine[c] + 1 urea[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-06_008580
- ESILICULOSUS_GENOME
- AUTOMATED-NAME-MATCH
- ESILICULOSUS_GENOME
Pathways
- CRNFORCAT-PWY, creatinine degradation I: CRNFORCAT-PWY
- 1 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links