Difference between revisions of "3-BETA-D-GLUCOSYLGLUCOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12443 CPD-12443] == * common name: ** perillate * Synonym(s): ** perillic acid ** perillyl...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12443 CPD-12443] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** perillate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** perillic acid |
| + | ** perillyl carboxylate | ||
| + | ** 4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid | ||
| + | ** 4-isopropenylcyclohex-1-enecarboxylic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14280]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=perillate}} | |
| − | + | {{#set: common name=perillic acid|perillyl carboxylate|4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid|4-isopropenylcyclohex-1-enecarboxylic acid}} | |
| − | + | {{#set: reversible reaction associated=RXN-14280}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
Revision as of 21:24, 17 March 2018
Contents
Metabolite CPD-12443
- common name:
- perillate
- Synonym(s):
- perillic acid
- perillyl carboxylate
- 4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid
- 4-isopropenylcyclohex-1-enecarboxylic acid
