Difference between revisions of "L-LACTATE-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O * inchi key: **...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6964 PWY-6964] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6964 PWY-6964] ==
−
* smiles:
+
* taxonomic range:
−
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2836 TAX-2836]
−
** InChIKey=NCMVOABPESMRCP-SHYZEUOFSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** dCMP
+
** ammonia assimilation cycle II
−
* molecular weight:
+
−
** 305.183   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxycytidine 5'-monophosphate
+
** GS/GOGAT pathway
−
** deoxycytidylate
+
−
** deoxycytidylic acid
+
−
** deoxycytidine monophosphate
+
−
** 2'-deoxycytidine 5'-phosphate
+
−
** deoxycytidine-phosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-7913]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
−
* [[DCMP-DEAMINASE-RXN]]
+
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 3 associated gene(s):
−
* [[RXN-14187]]
+
*** [[Ec-26_004630]]
−
* [[RXN-14198]]
+
*** [[Ec-00_000720]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-27_004970]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GLUTAMINESYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-15_004110]]
 +
*** [[Ec-21_003610]]
 +
*** [[Ec-09_000640]]
 +
*** [[Ec-15_004120]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 1032-65-1
+
{{#set: taxonomic range=TAX-1117}}
−
* BIGG : 34352
+
{{#set: taxonomic range=TAX-2836}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058169 7058169]
+
{{#set: common name=ammonia assimilation cycle II}}
−
* HMDB : HMDB01202
+
{{#set: common name=GS/GOGAT pathway}}
−
* LIGAND-CPD:
+
{{#set: reaction found=2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00239 C00239]
+
{{#set: total reaction=2}}
−
* CHEMSPIDER:
+
{{#set: completion rate=100.0}}
−
** [http://www.chemspider.com/Chemical-Structure.5414501.html 5414501]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57566 57566]
+
−
* METABOLIGHTS : MTBLC57566
+
−
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=NCMVOABPESMRCP-SHYZEUOFSA-L}}
+
−
{{#set: common name=dCMP}}
+
−
{{#set: molecular weight=305.183    }}
+
−
{{#set: common name=2'-deoxycytidine 5'-monophosphate|deoxycytidylate|deoxycytidylic acid|deoxycytidine monophosphate|2'-deoxycytidine 5'-phosphate|deoxycytidine-phosphate}}
+
−
{{#set: consumed by=RXN-7913|DCMP-DEAMINASE-RXN}}
+
−
{{#set: produced by=RXN-14187|RXN-14198}}
+

Revision as of 21:25, 17 March 2018

Pathway PWY-6964

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-LACTATE-DEHYDROGENASE-RXN&oldid=12909"