Difference between revisions of "RXN-11109"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15740 RXN-15740] == * direction: ** LEFT-TO-RIGHT * common name: ** glycerol-3-phosphate dehydr...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15740 RXN-15740] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glycerol-3-phosphate dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Menaquinones]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[Menaquinols]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a menaquinone[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 a menaquinol[c] '''+''' 1 glycerone phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Ec-10_003310]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PWY0-1582]], glycerol-3-phosphate to fumarate electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1582 PWY0-1582] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY0-1581]], nitrate reduction IX (dissimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1581 PWY0-1581] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=glycerol-3-phosphate dehydrogenase}} | |
− | + | {{#set: ec number=EC-1.1.5.3}} | |
− | + | {{#set: gene associated=Ec-10_003310}} | |
− | + | {{#set: in pathway=PWY0-1582|PWY0-1581}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:25, 17 March 2018
Contents
Reaction RXN-15740
- direction:
- LEFT-TO-RIGHT
- common name:
- glycerol-3-phosphate dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Menaquinones[c] + 1 GLYCEROL-3P[c] => 1 Menaquinols[c] + 1 DIHYDROXY-ACETONE-PHOSPHATE[c]
- With common name(s):
- 1 a menaquinone[c] + 1 sn-glycerol 3-phosphate[c] => 1 a menaquinol[c] + 1 glycerone phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-10_003310
- ESILICULOSUS_GENOME
- GO-TERM
- ESILICULOSUS_GENOME
Pathways
- PWY0-1582, glycerol-3-phosphate to fumarate electron transfer: PWY0-1582
- 1 reactions found over 2 reactions in the full pathway
- PWY0-1581, nitrate reduction IX (dissimilatory): PWY0-1581
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome