Difference between revisions of "2.3.1.23-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-16_004700 == * left end position: ** 4801309 * transcription direction: ** POSITIVE * right end position: ** 4805578 * centisome position: ** 89.9...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-16_004700 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] ==
−
* left end position:
+
* smiles:
−
** 4801309
+
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
−
* right end position:
+
* common name:
−
** 4805578
+
** α-D-ribose 5-phosphate
−
* centisome position:
+
* molecular weight:
−
** 89.95167    
+
** 228.095    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0164_0059
+
** α-D-ribofuranose 5-phosphate
−
** Esi0164_0059
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[CARBODEHYDRAT-RXN]]
+
* [[RXN-14997]]
−
** esiliculosus_genome
+
* [[RXN-15345]]
−
***go-term
+
== Reaction(s) known to produce the compound ==
−
* [[RXN0-5224]]
+
* [[RIBOKIN-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
−
***go-term
+
−
== Pathways associated ==
+
−
* [[PWY-241]]
+
−
* [[PWYQT-4429]]
+
−
* [[PWY-7117]]
+
−
* [[PWY-7115]]
+
−
* [[PWY-6142]]
+
−
* [[CYANCAT-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4801309}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098640 7098640]
−
{{#set: right end position=4805578}}
+
* CHEBI:
−
{{#set: centisome position=89.95167   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18189 18189]
−
{{#set: common name=Esi_0164_0059|Esi0164_0059}}
+
* METABOLIGHTS : MTBLC18189
−
{{#set: reaction associated=CARBODEHYDRAT-RXN|RXN0-5224}}
+
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
−
{{#set: pathway associated=PWY-241|PWYQT-4429|PWY-7117|PWY-7115|PWY-6142|CYANCAT-PWY}}
+
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L}}
 +
{{#set: common name=α-D-ribose 5-phosphate}}
 +
{{#set: molecular weight=228.095   }}
 +
{{#set: common name=α-D-ribofuranose 5-phosphate}}
 +
{{#set: consumed by=RXN-14997|RXN-15345}}
 +
{{#set: produced by=RIBOKIN-RXN}}

Revision as of 21:26, 17 March 2018

Metabolite CPD-15318

  • smiles:
    • C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
  • inchi key:
    • InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
  • common name:
    • α-D-ribose 5-phosphate
  • molecular weight:
    • 228.095
  • Synonym(s):
    • α-D-ribofuranose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2.3.1.23-RXN&oldid=12986"