Difference between revisions of "Ec-16 004700"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7092 PWY-7092] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7092 PWY-7092] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** neolinustatin bioactivation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[RXN-13603]] | |
| − | == Reaction(s) | + | ** 5 associated gene(s): |
| + | *** [[Ec-07_001850]] | ||
| + | *** [[Ec-20_004800]] | ||
| + | *** [[Ec-07_005240]] | ||
| + | *** [[Ec-04_002190]] | ||
| + | *** [[Ec-26_002410]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN-9674]] | ||
| + | ** 5 associated gene(s): | ||
| + | *** [[Ec-07_005240]] | ||
| + | *** [[Ec-04_002190]] | ||
| + | *** [[Ec-07_001850]] | ||
| + | *** [[Ec-26_002410]] | ||
| + | *** [[Ec-20_004800]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11733 RXN-11733] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-58024}} | |
| − | + | {{#set: common name=neolinustatin bioactivation}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=67.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 21:26, 17 March 2018
Pathway PWY-7092
- taxonomic range:
- common name:
- neolinustatin bioactivation
- Synonym(s):
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- RXN-13603
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9674
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
