Difference between revisions of "Ec-05 004910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-05_004910 == * left end position: ** 6918130 * transcription direction: ** NEGATIVE * right end position: ** 6925066 * centisome position: ** 75.9...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-05_004910 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] ==
−
* left end position:
+
* smiles:
−
** 6918130
+
** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N
−
* right end position:
+
* common name:
−
** 6925066
+
** β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
−
* centisome position:
+
* molecular weight:
−
** 75.99415    
+
** 488.442    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0229_0014
 
−
** Esi0229_0014
 
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-6883]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-12270]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-4302]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6918130}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C19966 C19966]
−
{{#set: right end position=6925066}}
+
* CHEBI:
−
{{#set: centisome position=75.99415    }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63259 63259]
−
{{#set: common name=Esi_0229_0014|Esi0229_0014}}
+
* PUBCHEM:
−
{{#set: reaction associated=RXN-6883}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940204 52940204]
−
{{#set: pathway associated=PWY-4302}}
+
{{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))}}
 +
{{#set: inchi key=InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N}}
 +
{{#set: common name=β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp}}
 +
{{#set: molecular weight=488.442    }}
 +
{{#set: produced by=RXN-12270}}

Revision as of 22:26, 17 March 2018

Metabolite CPD-13188

  • smiles:
    • CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))
  • inchi key:
    • InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N
  • common name:
    • β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
  • molecular weight:
    • 488.442
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_004910&oldid=13014"