Difference between revisions of "Ec-07 006660"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17626 RXN-17626] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18490 CPD-18490] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17626 RXN-17626] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J
+
−
* common name:
+
−
** (2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA
+
−
* molecular weight:
+
−
** 1104.05   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17111]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-19065]][c] '''=>''' 1 [[METHYL-GLYOXAL]][c] '''+''' 1 [[WATER]][c]
−
* [[RXN-17110]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 1,1-dihydroxypropan-2-one[c] '''=>''' 1 methylglyoxal[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=AVRCOFDAWHWKMB-MNTHWFIHSA-J}}
+
{{#set: in pathway=}}
−
{{#set: common name=(2E,9Z,12Z,15Z,18Z)-tetracosa-2,9,12,15,18-pentaenoyl-CoA}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=1104.05    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=(2E,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=RXN-17111}}
+
−
{{#set: produced by=RXN-17110}}
+

Revision as of 21:27, 17 March 2018

Reaction RXN-17626

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 1,1-dihydroxypropan-2-one[c] => 1 methylglyoxal[c] + 1 H2O[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_006660&oldid=13064"