Difference between revisions of "Ec-06 002520"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13698 RXN-13698] == * direction: ** REVERSIBLE * common name: ** Glutamate:glyoxylate aminotran...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13698 RXN-13698] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
+
 
* common name:
 
* common name:
−
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
+
** Glutamate:glyoxylate aminotransferase
−
* molecular weight:
+
* ec number:
−
** 396.655   
+
** [http://enzyme.expasy.org/EC/2.6.1.2 EC-2.6.1.2]
 
* Synonym(s):
 
* Synonym(s):
−
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11881]]
+
** 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[GLT]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-alanine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 pyruvate[c] '''+''' 1 L-glutamate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-01_011040]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117]
 +
** '''9''' reactions found over '''10''' reactions in the full pathway
 +
* [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986075 50986075]
+
{{#set: common name=Glutamate:glyoxylate aminotransferase}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: ec number=EC-2.6.1.2}}
−
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
+
{{#set: gene associated=Ec-01_011040}}
−
{{#set: common name=4&alpha;-methyl-5&alpha;-cholesta-8,14,24-trien-3&beta;-ol}}
+
{{#set: in pathway=PWY-7117|PWY-7115}}
−
{{#set: molecular weight=396.655    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3&beta;,4&alpha;,5&alpha;)-}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: produced by=RXN-11881}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 22:27, 17 March 2018

Reaction RXN-13698

  • direction:
    • REVERSIBLE
  • common name:
    • Glutamate:glyoxylate aminotransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7117, C4 photosynthetic carbon assimilation cycle, PEPCK type: PWY-7117
    • 9 reactions found over 10 reactions in the full pathway
  • PWY-7115, C4 photosynthetic carbon assimilation cycle, NAD-ME type: PWY-7115
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_002520&oldid=13070"