Difference between revisions of "RXN-5471"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Gene == Gene Ec-26_005690 == * left end position: ** 5845448 * transcription direction: ** NEGATIVE * right end position: ** 5854282 * centisome position: ** 88.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_005690 == |
− | * | + | * left end position: |
− | ** | + | ** 5845448 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5854282 |
− | * | + | * centisome position: |
− | ** | + | ** 88.79142 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0059_0103 |
− | ** | + | ** Esi0059_0103 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[3.4.21.92-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***go-term |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: left end position=5845448}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5854282}} | |
− | + | {{#set: centisome position=88.79142 }} | |
− | + | {{#set: common name=Esi_0059_0103|Esi0059_0103}} | |
− | + | {{#set: reaction associated=3.4.21.92-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 21:27, 17 March 2018
Gene Ec-26_005690
- left end position:
- 5845448
- transcription direction:
- NEGATIVE
- right end position:
- 5854282
- centisome position:
- 88.79142
- Synonym(s):
- Esi_0059_0103
- Esi0059_0103
Reactions associated
- 3.4.21.92-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome