Difference between revisions of "Menaquinones"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.27.1-RXN 3.1.27.1-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonuclease T2 * ec...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
+ | * inchi key: | ||
+ | ** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** (5α)-campestan-3-one |
− | * | + | * molecular weight: |
− | ** | + | ** 400.687 |
* Synonym(s): | * Synonym(s): | ||
+ | ** methylcholestanone | ||
+ | ** (24R)-24-methyl-5α-cholestan-3-one | ||
+ | ** 3-dehydro-campestanol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-711]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201374 25201374] |
− | + | * LIGAND-CPD: | |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786] |
− | ** [http://www. | + | * HMDB : HMDB12116 |
− | * | + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}} |
− | + | {{#set: common name=(5α)-campestan-3-one}} | |
− | + | {{#set: molecular weight=400.687 }} | |
− | {{#set: | + | {{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}} |
− | {{#set: | + | {{#set: produced by=RXN-711}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:28, 17 March 2018
Contents
Metabolite CPD-709
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
- common name:
- (5α)-campestan-3-one
- molecular weight:
- 400.687
- Synonym(s):
- methylcholestanone
- (24R)-24-methyl-5α-cholestan-3-one
- 3-dehydro-campestanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.