Difference between revisions of "Ec-27 005790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...")
 
(Created page with "Category:Gene == Gene Ec-17_003970 == * left end position: ** 4216896 * transcription direction: ** POSITIVE * right end position: ** 4231291 * centisome position: ** 87.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] ==
+
== Gene Ec-17_003970 ==
−
* smiles:
+
* left end position:
−
** C=C1(C(CC([N+])C([O-])=O)C1)
+
** 4216896
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** hypoglycin A
+
** 4231291
−
* molecular weight:
+
* centisome position:
−
** 141.169    
+
** 87.889595    
 
* Synonym(s):
 
* Synonym(s):
−
** hypoglycine
+
** Esi_0158_0003
−
** hypoglycine A
+
** Esi0158_0003
−
** hypoglycin
+
−
** L-β-(methylenecyclopropyl)-alanine
+
−
** 2-amino-3-(2-methylidenecyclopropyl)propanoic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9157]]
+
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4216896}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244430 25244430]
+
{{#set: transcription direction=POSITIVE}}
−
* Wikipedia : Hypoglycin
+
{{#set: right end position=4231291}}
−
* LIGAND-CPD:
+
{{#set: centisome position=87.889595   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08287 C08287]
+
{{#set: common name=Esi_0158_0003|Esi0158_0003}}
−
* HMDB : HMDB29427
+
{{#set: reaction associated=GLUTAMINE--TRNA-LIGASE-RXN}}
−
{{#set: smiles=C=C1(C(CC([N+])C([O-])=O)C1)}}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
{{#set: inchi key=InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N}}
+
−
{{#set: common name=hypoglycin A}}
+
−
{{#set: molecular weight=141.169   }}
+
−
{{#set: common name=hypoglycine|hypoglycine A|hypoglycin|L-β-(methylenecyclopropyl)-alanine|2-amino-3-(2-methylidenecyclopropyl)propanoic acid}}
+
−
{{#set: consumed by=RXN-9157}}
+

Revision as of 21:28, 17 March 2018

Gene Ec-17_003970

  • left end position:
    • 4216896
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4231291
  • centisome position:
    • 87.889595
  • Synonym(s):
    • Esi_0158_0003
    • Esi0158_0003

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_005790&oldid=13120"