Difference between revisions of "CPD-37"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_000710 == * left end position: ** 721881 * transcription direction: ** POSITIVE * right end position: ** 726514 * centisome position: ** 10.779...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == |
− | * | + | * smiles: |
− | ** | + | ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-]) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N |
− | * | + | * common name: |
− | ** | + | ** N-formylkynurenine |
− | * | + | * molecular weight: |
− | ** | + | ** 236.227 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** N-Formyl-L-kynurenine |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-8665]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 1022-31-7 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202092 25202092] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58629 58629] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02700 C02700] | ||
+ | * HMDB : HMDB60485 | ||
+ | {{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])}} | ||
+ | {{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N}} | ||
+ | {{#set: common name=N-formylkynurenine}} | ||
+ | {{#set: molecular weight=236.227 }} | ||
+ | {{#set: common name=N-Formyl-L-kynurenine}} | ||
+ | {{#set: produced by=RXN-8665}} |
Revision as of 21:28, 17 March 2018
Contents
Metabolite N-FORMYLKYNURENINE
- smiles:
- [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])
- inchi key:
- InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N
- common name:
- N-formylkynurenine
- molecular weight:
- 236.227
- Synonym(s):
- N-Formyl-L-kynurenine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])" cannot be used as a page name in this wiki.