Difference between revisions of "TransportSeed NA+"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHURENATE XANTHURENATE] == * smiles: ** C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-])) * inch...") |
(Created page with "Category:Gene == Gene Ec-27_006890 == * left end position: ** 6313735 * transcription direction: ** POSITIVE * right end position: ** 6318288 * centisome position: ** 97.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_006890 == |
− | * | + | * left end position: |
− | ** | + | ** 6313735 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 6318288 |
− | * | + | * centisome position: |
− | ** | + | ** 97.88877 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0339_0011 | ||
+ | ** Esi0339_0011 | ||
+ | ** SAMDC | ||
− | == | + | == Reactions associated == |
− | + | * [[SAMDECARB-RXN]] | |
− | * [[RXN- | + | ** esiliculosus_genome |
− | == | + | ***ec-number |
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[BSUBPOLYAMSYN-PWY]] | ||
+ | * [[ARGSPECAT-PWY]] | ||
+ | * [[PWY-6834]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6313735}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=6318288}} | |
− | + | {{#set: centisome position=97.88877 }} | |
− | + | {{#set: common name=Esi_0339_0011|Esi0339_0011|SAMDC}} | |
− | + | {{#set: reaction associated=SAMDECARB-RXN}} | |
− | + | {{#set: pathway associated=BSUBPOLYAMSYN-PWY|ARGSPECAT-PWY|PWY-6834}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:28, 17 March 2018
Gene Ec-27_006890
- left end position:
- 6313735
- transcription direction:
- POSITIVE
- right end position:
- 6318288
- centisome position:
- 97.88877
- Synonym(s):
- Esi_0339_0011
- Esi0339_0011
- SAMDC
Reactions associated
- SAMDECARB-RXN
- esiliculosus_genome
- ec-number
- pantograph-aragem
- esiliculosus_genome