Difference between revisions of "GUANOSINE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-22_000860 == * left end position: ** 999973 * transcription direction: ** POSITIVE * right end position: ** 1006566 * centisome position: ** 22.14...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-479 CPD-479] == * smiles: ** CSCCC(C([O-])=O)=O * inchi key: ** InChIKey=SXFSQZDSUWACKX-UHF...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-479 CPD-479] == |
− | * | + | * smiles: |
− | ** | + | ** CSCCC(C([O-])=O)=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SXFSQZDSUWACKX-UHFFFAOYSA-M |
− | * | + | * common name: |
− | ** | + | ** 2-oxo-4-methylthiobutanoate |
− | * | + | * molecular weight: |
− | ** | + | ** 147.168 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-keto-methyl-thio-butyrate |
− | ** | + | ** 2-keto-4-methylthiobutyrate |
+ | ** 4-methylthio-2-oxobutanoate | ||
+ | ** α-keto-4-methylthiobutyrate | ||
+ | ** 4-methylthio-2-ketobutyrate | ||
+ | ** 4-methylthio-2-ketobutanoate | ||
+ | ** 4-methylthio-2-oxobutyrate | ||
+ | ** 2-ketomethiobutyrate | ||
+ | ** KMTB | ||
+ | ** α-ketomethiobutyrate | ||
+ | ** 2-keto-4-methylthiobutyric acid | ||
+ | ** α-ketomethiobutyric acid | ||
+ | ** α-keto-γ-methylthiobutyrate | ||
+ | ** α-keto-γ-methylthiobutyric acid | ||
+ | ** 2-oxo-4-methylthiobutanoic acid | ||
+ | ** 2-oxomethionine | ||
+ | ** 2-keto-4-methylthiobutanoate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-12539]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[R15-RXN-MET/P-HYDROXY-PHENYLPYRUVATE//CPD-479/TYR.42.]] | |
− | == | + | * [[R147-RXN]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : 228408 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4584184 4584184] |
− | {{#set: | + | * HMDB : HMDB01553 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01180 C01180] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3776616.html 3776616] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16723 16723] | ||
+ | * METABOLIGHTS : MTBLC16723 | ||
+ | {{#set: smiles=CSCCC(C([O-])=O)=O}} | ||
+ | {{#set: inchi key=InChIKey=SXFSQZDSUWACKX-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=2-oxo-4-methylthiobutanoate}} | ||
+ | {{#set: molecular weight=147.168 }} | ||
+ | {{#set: common name=2-keto-methyl-thio-butyrate|2-keto-4-methylthiobutyrate|4-methylthio-2-oxobutanoate|α-keto-4-methylthiobutyrate|4-methylthio-2-ketobutyrate|4-methylthio-2-ketobutanoate|4-methylthio-2-oxobutyrate|2-ketomethiobutyrate|KMTB|α-ketomethiobutyrate|2-keto-4-methylthiobutyric acid|α-ketomethiobutyric acid|α-keto-γ-methylthiobutyrate|α-keto-γ-methylthiobutyric acid|2-oxo-4-methylthiobutanoic acid|2-oxomethionine|2-keto-4-methylthiobutanoate}} | ||
+ | {{#set: consumed by=RXN-12539}} | ||
+ | {{#set: produced by=R15-RXN-MET/P-HYDROXY-PHENYLPYRUVATE//CPD-479/TYR.42.|R147-RXN}} |
Revision as of 21:28, 17 March 2018
Contents
Metabolite CPD-479
- smiles:
- CSCCC(C([O-])=O)=O
- inchi key:
- InChIKey=SXFSQZDSUWACKX-UHFFFAOYSA-M
- common name:
- 2-oxo-4-methylthiobutanoate
- molecular weight:
- 147.168
- Synonym(s):
- 2-keto-methyl-thio-butyrate
- 2-keto-4-methylthiobutyrate
- 4-methylthio-2-oxobutanoate
- α-keto-4-methylthiobutyrate
- 4-methylthio-2-ketobutyrate
- 4-methylthio-2-ketobutanoate
- 4-methylthio-2-oxobutyrate
- 2-ketomethiobutyrate
- KMTB
- α-ketomethiobutyrate
- 2-keto-4-methylthiobutyric acid
- α-ketomethiobutyric acid
- α-keto-γ-methylthiobutyrate
- α-keto-γ-methylthiobutyric acid
- 2-oxo-4-methylthiobutanoic acid
- 2-oxomethionine
- 2-keto-4-methylthiobutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 228408
- PUBCHEM:
- HMDB : HMDB01553
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16723
"CSCCC(C([O-])=O)=O" cannot be used as a page name in this wiki.