Difference between revisions of "Ec-19 004160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-26_005670 == * left end position: ** 5802717 * transcription direction: ** NEGATIVE * right end position: ** 5826667 * centisome position: ** 88.1...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-26_005670 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] ==
−
* left end position:
+
* smiles:
−
** 5802717
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
−
* right end position:
+
* common name:
−
** 5826667
+
** episterol
−
* centisome position:
+
* molecular weight:
−
** 88.14234    
+
** 398.671    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0059_0106
 
−
** Esi0059_0106
 
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[INORGPYROPHOSPHAT-RXN]]
+
* [[RXN3O-218]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=5802717}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571]
−
{{#set: right end position=5826667}}
+
* CHEBI:
−
{{#set: centisome position=88.14234    }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586]
−
{{#set: common name=Esi_0059_0106|Esi0059_0106}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=INORGPYROPHOSPHAT-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777]
 +
* HMDB : HMDB06847
 +
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}}
 +
{{#set: common name=episterol}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: consumed by=RXN3O-218}}

Revision as of 21:28, 17 March 2018

Metabolite EPISTEROL

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
  • inchi key:
    • InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
  • common name:
    • episterol
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_004160&oldid=13176"