Difference between revisions of "Ec-27 005300"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([...")
 
(Created page with "Category:Gene == Gene Ec-22_000950 == * left end position: ** 1120479 * transcription direction: ** POSITIVE * right end position: ** 1130367 * centisome position: ** 24.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
+
== Gene Ec-22_000950 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
+
** 1120479
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-hydroxy-2-nonenal-glutathione conjugate
+
** 1130367
−
* molecular weight:
+
* centisome position:
−
** 462.537    
+
** 24.812134    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0065_0115
 +
** Esi0065_0115
 +
** NFS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-12587]]
−
* [[RXN-13673]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[RXN-12588]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-14382]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-14384]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-14385]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-14386]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-15881]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-9787]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN0-308]]
 +
** esiliculosus_genome
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1021]]
 +
* [[PWY-6823]]
 +
* [[PWY-7250]]
 +
* [[PWY-6892]]
 +
* [[PWY-6891]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1120479}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
+
{{#set: right end position=1130367}}
−
{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
+
{{#set: centisome position=24.812134    }}
−
{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
+
{{#set: common name=Esi_0065_0115|Esi0065_0115|NFS}}
−
{{#set: molecular weight=462.537    }}
+
{{#set: reaction associated=RXN-12587|RXN-12588|RXN-14382|RXN-14384|RXN-14385|RXN-14386|RXN-15881|RXN-9787|RXN0-308}}
−
{{#set: produced by=RXN-13673}}
+
{{#set: pathway associated=PWY0-1021|PWY-6823|PWY-7250|PWY-6892|PWY-6891}}

Revision as of 21:28, 17 March 2018

Gene Ec-22_000950

  • left end position:
    • 1120479
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1130367
  • centisome position:
    • 24.812134
  • Synonym(s):
    • Esi_0065_0115
    • Esi0065_0115
    • NFS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_005300&oldid=13178"