Difference between revisions of "Ec-00 002670"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Ec-06_008170 == * left end position: ** 5831920 * transcription direction: ** POSITIVE * right end position: ** 5847963 * centisome position: ** 66.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_008170 == |
− | * | + | * left end position: |
− | ** | + | ** 5831920 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5847963 |
− | * | + | * centisome position: |
− | ** | + | ** 66.59147 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0028_0153 | ||
+ | ** Esi0028_0153 | ||
+ | ** CDK | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
− | * | + | ** esiliculosus_genome |
− | * | + | ***go-term |
− | + | == Pathways associated == | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=5831920}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5847963}} | |
− | + | {{#set: centisome position=66.59147 }} | |
− | + | {{#set: common name=Esi_0028_0153|Esi0028_0153|CDK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:29, 17 March 2018
Gene Ec-06_008170
- left end position:
- 5831920
- transcription direction:
- POSITIVE
- right end position:
- 5847963
- centisome position:
- 66.59147
- Synonym(s):
- Esi_0028_0153
- Esi0028_0153
- CDK
Reactions associated
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome