Difference between revisions of "RXN-12507"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...")
 
(Created page with "Category:Gene == Gene Ec-07_001070 == * Synonym(s): ** Esi_0045_0057 ** Esi0045_0057 == Reactions associated == * RXN490-3641 ** pantograph-aragem == Pathways...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] ==
+
== Gene Ec-07_001070 ==
* smiles:
+
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
+
* inchi key:
+
** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
+
* common name:
+
** α,α-trehalose 6-phosphate
+
* molecular weight:
+
** 420.263   
+
 
* Synonym(s):
 
* Synonym(s):
** α,α-D-trehalose 6-phosphate
+
** Esi_0045_0057
 +
** Esi0045_0057
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[TREHALOSEPHOSPHA-RXN]]
+
* [[RXN490-3641]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[aragem]]
* [[TREHALOSE6PSYN-RXN]]
+
== Pathways associated ==
* [[2.4.1.36-RXN]]
+
== Reaction(s) of unknown directionality ==
+
* [[RXN-761]]
+
 
== External links  ==
 
== External links  ==
* CAS : 4484-88-2
+
{{#set: common name=Esi_0045_0057|Esi0045_0057}}
* PUBCHEM:
+
{{#set: reaction associated=RXN490-3641}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105]
+
* HMDB : HMDB01124
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429]
+
* BIGG : 35708
+
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}}
+
{{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}}
+
{{#set: common name=α,α-trehalose 6-phosphate}}
+
{{#set: molecular weight=420.263    }}
+
{{#set: common name=α,α-D-trehalose 6-phosphate}}
+
{{#set: consumed by=TREHALOSEPHOSPHA-RXN}}
+
{{#set: produced by=TREHALOSE6PSYN-RXN|2.4.1.36-RXN}}
+
{{#set: consumed or produced by=RXN-761}}
+

Revision as of 21:29, 17 March 2018

Gene Ec-07_001070

  • Synonym(s):
    • Esi_0045_0057
    • Esi0045_0057

Reactions associated

Pathways associated

External links