Difference between revisions of "Ec-28 003630"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * inchi ke...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-4-aminobutylidene-enzyme-lysine N-4-aminobutylidene-enzyme-lysine] == * common name: ** a [de...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-4-aminobutylidene-enzyme-lysine N-4-aminobutylidene-enzyme-lysine] ==
−
* smiles:
+
−
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O
+
−
* inchi key:
+
−
** InChIKey=HDTRYLNUVZCQOY-LIZSDCNHSA-N
+
 
* common name:
 
* common name:
−
** α,α-trehalose
+
** a [deoxyhypusine synthase]-N-(4-aminobutylidene)-lysine
−
* molecular weight:
+
−
** 342.299   
+
 
* Synonym(s):
 
* Synonym(s):
−
** α-D-glucopyranosyl α-D-glucopyranoside
+
** an N-(4-aminobutylidene)-[enzyme]-lysine
−
** α-D-Glcp-(1↔1)-α-D-Glcp
+
−
** D-(+)-trehalose
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[TREHALA-RXN]]
+
* [[RXN-13416]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[TREHALOSEPHOSPHA-RXN]]
+
* [[RXN-13415]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 99-20-7
+
{{#set: common name=a [deoxyhypusine synthase]-N-(4-aminobutylidene)-lysine}}
−
* BIGG : 36774
+
{{#set: common name=an N-(4-aminobutylidene)-[enzyme]-lysine}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN-13416}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7427 7427]
+
{{#set: produced by=RXN-13415}}
−
* KEGG-GLYCAN : G00293
+
−
* HMDB : HMDB00975
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01083 C01083]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.7149.html 7149]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16551 16551]
+
−
* METABOLIGHTS : MTBLC16551
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O}}
+
−
{{#set: inchi key=InChIKey=HDTRYLNUVZCQOY-LIZSDCNHSA-N}}
+
−
{{#set: common name=α,α-trehalose}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=α-D-glucopyranosyl α-D-glucopyranoside|α-D-Glcp-(1↔1)-α-D-Glcp|D-(+)-trehalose}}
+
−
{{#set: consumed by=TREHALA-RXN}}
+
−
{{#set: produced by=TREHALOSEPHOSPHA-RXN}}
+

Revision as of 21:29, 17 March 2018

Metabolite N-4-aminobutylidene-enzyme-lysine

  • common name:
    • a [deoxyhypusine synthase]-N-(4-aminobutylidene)-lysine
  • Synonym(s):
    • an N-(4-aminobutylidene)-[enzyme]-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [deoxyhypusine synthase]-N-(4-aminobutylidene)-lysine" cannot be used as a page name in this wiki.
"an N-(4-aminobutylidene)-[enzyme]-lysine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-28_003630&oldid=13236"