Difference between revisions of "RXN-11152"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-07_001850 == * left end position: ** 2006468 * transcription direction: ** NEGATIVE * right end position: ** 2016207 * centisome position: ** 25.9...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] == * smiles: ** CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-07_001850 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] ==
* left end position:
+
* smiles:
** 2006468
+
** CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J
* right end position:
+
* common name:
** 2016207
+
** (2E,5Z)-tetradecenoyl-CoA
* centisome position:
+
* molecular weight:
** 25.982342    
+
** 969.83    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0061_0010
+
** 2-trans,5-cis-tetradecenoyl-CoA
** Esi0061_0010
+
** 14:2-Δ2,Δ5-CoA
 +
** 2-trans,5-cis-tetradecadienoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.2.1.21-RXN]]
+
* [[RXN0-5393]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-14576]]
* [[RXN-10769]]
+
* [[RXN-17783]]
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[RXN-10773]]
+
** esiliculosus_genome
+
***ec-number
+
* [[RXN-13600]]
+
** esiliculosus_genome
+
***ec-number
+
* [[RXN-13602]]
+
** esiliculosus_genome
+
***ec-number
+
* [[RXN-13603]]
+
** esiliculosus_genome
+
***ec-number
+
* [[RXN-14179]]
+
** esiliculosus_genome
+
***ec-number
+
* [[RXN-5341]]
+
** esiliculosus_genome
+
***ec-number
+
* [[RXN-8036]]
+
** esiliculosus_genome
+
***ec-number
+
* [[RXN-9674]]
+
** esiliculosus_genome
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-3121]]
+
* [[PWY-6002]]
+
* [[PWY-6788]]
+
* [[PWY-5176]]
+
* [[PWY-7092]]
+
* [[PWY-7091]]
+
* [[PWY-7089]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2006468}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244134 25244134]
{{#set: right end position=2016207}}
+
* CHEBI:
{{#set: centisome position=25.982342   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87701 87701]
{{#set: common name=Esi_0061_0010|Esi0061_0010}}
+
{{#set: smiles=CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
{{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13600|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}}
+
{{#set: inchi key=InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J}}
{{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091|PWY-7089}}
+
{{#set: common name=(2E,5Z)-tetradecenoyl-CoA}}
 +
{{#set: molecular weight=969.83   }}
 +
{{#set: common name=2-trans,5-cis-tetradecenoyl-CoA|14:2-Δ2,Δ5-CoA|2-trans,5-cis-tetradecadienoyl-CoA}}
 +
{{#set: consumed by=RXN0-5393}}
 +
{{#set: produced by=RXN-14576|RXN-17783}}

Revision as of 21:29, 17 March 2018

Metabolite CPD0-1162

  • smiles:
    • CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=JVEFYXPCQBMMAA-ZMLWRGBOSA-J
  • common name:
    • (2E,5Z)-tetradecenoyl-CoA
  • molecular weight:
    • 969.83
  • Synonym(s):
    • 2-trans,5-cis-tetradecenoyl-CoA
    • 14:2-Δ2,Δ5-CoA
    • 2-trans,5-cis-tetradecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.