Difference between revisions of "RXN-14177"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-28_003630 == * Synonym(s): ** Esi_0009_0037 ** Esi0009_0037 == Reactions associated == * ATPASE-RXN ** pantograph-aragem == Pathways...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K | ||
+ | * common name: | ||
+ | ** tetrahydrogeranylgeranyl diphosphate | ||
+ | * molecular weight: | ||
+ | ** 451.456 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** tetrahydroGGPP |
− | ** | + | ** tetrahydrogeranylgeranyl pyrophosphate |
+ | ** tetrahydrogeranylgeranyl-PP | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-7660]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-7659]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275] |
+ | {{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}} | ||
+ | {{#set: common name=tetrahydrogeranylgeranyl diphosphate}} | ||
+ | {{#set: molecular weight=451.456 }} | ||
+ | {{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}} | ||
+ | {{#set: consumed by=RXN-7660}} | ||
+ | {{#set: produced by=RXN-7659}} |
Revision as of 22:29, 17 March 2018
Contents
Metabolite CPD-7003
- smiles:
- CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
- inchi key:
- InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
- common name:
- tetrahydrogeranylgeranyl diphosphate
- molecular weight:
- 451.456
- Synonym(s):
- tetrahydroGGPP
- tetrahydrogeranylgeranyl pyrophosphate
- tetrahydrogeranylgeranyl-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.