Difference between revisions of "RXN-7645"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...")
 
(Created page with "Category:Gene == Gene Ec-13_002530 == * left end position: ** 4181090 * transcription direction: ** NEGATIVE * right end position: ** 4193679 * centisome position: ** 60.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] ==
+
== Gene Ec-13_002530 ==
−
* smiles:
+
* left end position:
−
** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
+
** 4181090
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 2'-hydroxynicotine
+
** 4193679
−
* molecular weight:
+
* centisome position:
−
** 179.241    
+
** 60.27868    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0330_0001
 +
** Esi0330_0001
 +
** AK1
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[ASPARTATEKIN-RXN]]
−
* [[RXN66-146]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 +
* [[HOMOSERSYN-PWY]]
 +
* [[PWY-7153]]
 +
* [[DAPLYSINESYN-PWY]]
 +
* [[PWY-2942]]
 +
* [[PWY-2941]]
 +
* [[PWY-6559]]
 +
* [[PWY-6562]]
 +
* [[PWY-5097]]
 +
* [[P101-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4181090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245599 25245599]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB01329
+
{{#set: right end position=4193679}}
−
{{#set: smiles=C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))}}
+
{{#set: centisome position=60.27868    }}
−
{{#set: inchi key=InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O}}
+
{{#set: common name=Esi_0330_0001|Esi0330_0001|AK1}}
−
{{#set: common name=2'-hydroxynicotine}}
+
{{#set: reaction associated=ASPARTATEKIN-RXN}}
−
{{#set: molecular weight=179.241    }}
+
{{#set: pathway associated=HOMOSERSYN-PWY|PWY-7153|DAPLYSINESYN-PWY|PWY-2942|PWY-2941|PWY-6559|PWY-6562|PWY-5097|P101-PWY}}
−
{{#set: produced by=RXN66-146}}
+

Revision as of 21:29, 17 March 2018

Gene Ec-13_002530

  • left end position:
    • 4181090
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4193679
  • centisome position:
    • 60.27868
  • Synonym(s):
    • Esi_0330_0001
    • Esi0330_0001
    • AK1

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-7645&oldid=13247"