Difference between revisions of "TRNA-pseudouridine-38-40"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN 4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN] == * direction: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] == * smiles: ** C(CCC(O)CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HNOA...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] == |
− | * | + | * smiles: |
− | ** | + | ** C(CCC(O)CC(C([O-])=O)=O)([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=HNOAJOYERZTSNK-BYPYZUCNSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** (4S)-4-hydroxy-2-oxoheptanedioate |
− | * | + | * molecular weight: |
− | ** | + | ** 188.137 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-hydroxy-2-ketoheptane-1,7-dioate | ||
+ | ** 2-oxo-4-hydroxyhepta-1,7-dioate | ||
+ | ** 4-hydroxy-2-oxo-heptanedioate | ||
+ | ** 4-hydroxy-2-ketopimelate | ||
+ | ** 2-keto-4-hydroxypimelate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615324 23615324] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.19951289.html 19951289] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73036 73036] | |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05601 C05601] |
− | + | {{#set: smiles=C(CCC(O)CC(C([O-])=O)=O)([O-])=O}} | |
− | * | + | {{#set: inchi key=InChIKey=HNOAJOYERZTSNK-BYPYZUCNSA-L}} |
− | ** [http://www. | + | {{#set: common name=(4S)-4-hydroxy-2-oxoheptanedioate}} |
− | {{#set: | + | {{#set: molecular weight=188.137 }} |
− | {{#set: | + | {{#set: common name=4-hydroxy-2-ketoheptane-1,7-dioate|2-oxo-4-hydroxyhepta-1,7-dioate|4-hydroxy-2-oxo-heptanedioate|4-hydroxy-2-ketopimelate|2-keto-4-hydroxypimelate}} |
− | {{#set: | + | {{#set: consumed by=4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 21:30, 17 March 2018
Contents
Metabolite CPD-804
- smiles:
- C(CCC(O)CC(C([O-])=O)=O)([O-])=O
- inchi key:
- InChIKey=HNOAJOYERZTSNK-BYPYZUCNSA-L
- common name:
- (4S)-4-hydroxy-2-oxoheptanedioate
- molecular weight:
- 188.137
- Synonym(s):
- 4-hydroxy-2-ketoheptane-1,7-dioate
- 2-oxo-4-hydroxyhepta-1,7-dioate
- 4-hydroxy-2-oxo-heptanedioate
- 4-hydroxy-2-ketopimelate
- 2-keto-4-hydroxypimelate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC(O)CC(C([O-])=O)=O)([O-])=O" cannot be used as a page name in this wiki.