Difference between revisions of "CPD-8291"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * inchi key: ** InChIKey=U...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == |
* smiles: | * smiles: | ||
− | ** | + | ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UNXRWKVEANCORM-UHFFFAOYSA-I |
* common name: | * common name: | ||
− | ** | + | ** PPPi |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 252.915 |
* Synonym(s): | * Synonym(s): | ||
+ | ** inorganic triphosphate | ||
+ | ** tripolyphosphate | ||
+ | ** triphosphate | ||
+ | ** inorganic open chain tripolyphosphate | ||
+ | ** P3,i | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[BTUR2-RXN]] |
+ | * [[R344-RXN]] | ||
+ | * [[4.2.3.12-RXN]] | ||
+ | * [[COBALADENOSYLTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 14127-68-5 | ||
+ | * BIGG : 41547 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3440921 3440921] |
− | {{#set: smiles= | + | * HMDB : HMDB03379 |
− | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00536 C00536] |
− | {{#set: molecular weight= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.2683694.html 2683694] |
− | {{#set: produced by=RXN- | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18036 18036] | ||
+ | * METABOLIGHTS : MTBLC18036 | ||
+ | {{#set: smiles=[O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=UNXRWKVEANCORM-UHFFFAOYSA-I}} | ||
+ | {{#set: common name=PPPi}} | ||
+ | {{#set: molecular weight=252.915 }} | ||
+ | {{#set: common name=inorganic triphosphate|tripolyphosphate|triphosphate|inorganic open chain tripolyphosphate|P3,i}} | ||
+ | {{#set: produced by=BTUR2-RXN|R344-RXN|4.2.3.12-RXN|COBALADENOSYLTRANS-RXN}} |
Revision as of 22:30, 17 March 2018
Contents
Metabolite P3I
- smiles:
- [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O
- inchi key:
- InChIKey=UNXRWKVEANCORM-UHFFFAOYSA-I
- common name:
- PPPi
- molecular weight:
- 252.915
- Synonym(s):
- inorganic triphosphate
- tripolyphosphate
- triphosphate
- inorganic open chain tripolyphosphate
- P3,i
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 14127-68-5
- BIGG : 41547
- PUBCHEM:
- HMDB : HMDB03379
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18036
"O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O" cannot be used as a page name in this wiki.