Difference between revisions of "RXN1G-488"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11480 RXN-11480] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)[N+])[N+] * inchi key: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(CCCCCC([O-])=O)[N+])[N+] |
+ | * inchi key: | ||
+ | ** InChIKey=KCEGBPIYGIWCDH-UHFFFAOYSA-O | ||
* common name: | * common name: | ||
− | ** | + | ** 7,8-diaminopelargonate |
− | * | + | * molecular weight: |
− | ** | + | ** 189.277 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 7,8-diaminononanoate | ||
+ | ** DAPA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[DETHIOBIOTIN-SYN-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[DAPASYN-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245451 25245451] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58500 58500] |
− | {{#set: | + | * BIGG : 36673 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01037 C01037] |
− | {{#set: | + | {{#set: smiles=CC(C(CCCCCC([O-])=O)[N+])[N+]}} |
+ | {{#set: inchi key=InChIKey=KCEGBPIYGIWCDH-UHFFFAOYSA-O}} | ||
+ | {{#set: common name=7,8-diaminopelargonate}} | ||
+ | {{#set: molecular weight=189.277 }} | ||
+ | {{#set: common name=7,8-diaminononanoate|DAPA}} | ||
+ | {{#set: consumed by=DETHIOBIOTIN-SYN-RXN}} | ||
+ | {{#set: reversible reaction associated=DAPASYN-RXN}} |
Revision as of 21:30, 17 March 2018
Contents
Metabolite DIAMINONONANOATE
- smiles:
- CC(C(CCCCCC([O-])=O)[N+])[N+]
- inchi key:
- InChIKey=KCEGBPIYGIWCDH-UHFFFAOYSA-O
- common name:
- 7,8-diaminopelargonate
- molecular weight:
- 189.277
- Synonym(s):
- 7,8-diaminononanoate
- DAPA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(CCCCCC([O-])=O)[N+])[N+" cannot be used as a page name in this wiki.