Difference between revisions of "3-oxo-behenoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)[N+])[N+] * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-00_002050 == * left end position: ** 2273622 * transcription direction: ** POSITIVE * right end position: ** 2285801 * centisome position: ** 12.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_002050 == |
− | * | + | * left end position: |
− | ** | + | ** 2273622 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2285801 |
− | * | + | * centisome position: |
− | ** | + | ** 12.000265 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0013_0201 |
− | ** | + | ** Esi0013_0201 |
+ | ** CAMK | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***go-term |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: left end position=2273622}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2285801}} | |
− | + | {{#set: centisome position=12.000265 }} | |
− | + | {{#set: common name=Esi_0013_0201|Esi0013_0201|CAMK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 21:31, 17 March 2018
Gene Ec-00_002050
- left end position:
- 2273622
- transcription direction:
- POSITIVE
- right end position:
- 2285801
- centisome position:
- 12.000265
- Synonym(s):
- Esi_0013_0201
- Esi0013_0201
- CAMK
Reactions associated
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome