Difference between revisions of "CPD-9864"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == * smiles: ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N |
* common name: | * common name: | ||
| − | ** | + | ** (2R,3S,4S)-leucodelphinidin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 322.271 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (2R,3S,4S)-leucoefdin | ||
| + | ** (2R,3S,4S)-leucodelfinidin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7784]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05909 C05909] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.2338991.html 2338991] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6417 6417] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC71216 |
| − | {{#set: smiles= | + | {{#set: smiles=C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=(2R,3S,4S)-leucodelphinidin}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=322.271 }} |
| − | {{#set: | + | {{#set: common name=(2R,3S,4S)-leucoefdin|(2R,3S,4S)-leucodelfinidin}} |
| − | {{#set: | + | {{#set: produced by=RXN-7784}} |
Revision as of 21:31, 17 March 2018
Contents
Metabolite CPD-7088
- smiles:
- C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)
- inchi key:
- InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N
- common name:
- (2R,3S,4S)-leucodelphinidin
- molecular weight:
- 322.271
- Synonym(s):
- (2R,3S,4S)-leucoefdin
- (2R,3S,4S)-leucodelfinidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
