Difference between revisions of "RXN-13414"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11334 RXN-11334] == * direction: ** REVERSIBLE * common name: ** Soluble quinoprotein glucose/s...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == |
− | * | + | * smiles: |
− | ** | + | ** [CH](=O)C(O)C(O)C(O)C(O)CO |
+ | * inchi key: | ||
+ | ** InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** aldehydo-D-mannose |
− | * | + | * molecular weight: |
− | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14501]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14500]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161658 161658] |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675] | |
− | {{#set: | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N}} |
− | {{#set: | + | {{#set: common name=aldehydo-D-mannose}} |
− | {{#set: | + | {{#set: molecular weight=180.157 }} |
− | {{#set: | + | {{#set: consumed by=RXN-14501}} |
− | + | {{#set: reversible reaction associated=RXN-14500}} |
Revision as of 21:31, 17 March 2018
Contents
Metabolite CPD-15373
- smiles:
- [CH](=O)C(O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
- common name:
- aldehydo-D-mannose
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.