Difference between revisions of "DISULISOM-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9864 CPD-9864] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...")
 
(Created page with "Category:Gene == Gene Ec-08_006390 == * left end position: ** 6205624 * transcription direction: ** POSITIVE * right end position: ** 6216159 * centisome position: ** 92.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9864 CPD-9864] ==
+
== Gene Ec-08_006390 ==
−
* smiles:
+
* left end position:
−
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C)C
+
** 6205624
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CMPNJZREBHCPHN-LTNIBBDRSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-decaprenyl-4-hydroxybenzoate
+
** 6216159
−
* molecular weight:
+
* centisome position:
−
** 818.297    
+
** 92.661835    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0005_0083
 +
** Esi0005_0083
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[ACYL-COA-OXIDASE-RXN]]
−
* [[RXN-9230]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
* [[ACYLCOADEHYDROG-RXN]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-10696]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-10706]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-10707]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-11026]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-12518]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-12669]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-14264]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[RXN-14576]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-14771]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-14775]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-14785]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-14789]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-14796]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-16134]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-17113]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6920]]
 +
* [[PWY-7340]]
 +
* [[PWY-7291]]
 +
* [[PWY-735]]
 +
* [[PWY-7606]]
 +
* [[PWY-7338]]
 +
* [[FAO-PWY]]
 +
* [[PWY66-391]]
 +
* [[PWY-5136]]
 +
* [[PWY-7726]]
 +
* [[PWY-7007]]
 +
* [[PWY-7337]]
 +
* [[PWY-7288]]
 +
* [[PWY-6837]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6205624}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54746224 54746224]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=6216159}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84503 84503]
+
{{#set: centisome position=92.661835    }}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C)C}}
+
{{#set: common name=Esi_0005_0083|Esi0005_0083}}
−
{{#set: inchi key=InChIKey=CMPNJZREBHCPHN-LTNIBBDRSA-M}}
+
{{#set: reaction associated=ACYL-COA-OXIDASE-RXN|ACYLCOADEHYDROG-RXN|LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN|RXN-10696|RXN-10706|RXN-10707|RXN-11026|RXN-12518|RXN-12669|RXN-14264|RXN-14576|RXN-14771|RXN-14775|RXN-14785|RXN-14789|RXN-14796|RXN-16134|RXN-17113}}
−
{{#set: common name=3-decaprenyl-4-hydroxybenzoate}}
+
{{#set: pathway associated=PWY-6920|PWY-7340|PWY-7291|PWY-735|PWY-7606|PWY-7338|FAO-PWY|PWY66-391|PWY-5136|PWY-7726|PWY-7007|PWY-7337|PWY-7288|PWY-6837}}
−
{{#set: molecular weight=818.297    }}
+
−
{{#set: produced by=RXN-9230}}
+

Revision as of 21:31, 17 March 2018

Gene Ec-08_006390

  • left end position:
    • 6205624
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6216159
  • centisome position:
    • 92.661835
  • Synonym(s):
    • Esi_0005_0083
    • Esi0005_0083

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DISULISOM-RXN&oldid=13345"