Difference between revisions of "CPD-15373"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-0 CPD1G-0] == * smiles: ** C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O) * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-0 CPD1G-0] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HEPUIGACZYVUCD-LFIKJOHQSA-O |
* common name: | * common name: | ||
− | ** | + | ** 1-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 342.322 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 6-(α-D-glucosaminyl)-1D-myo-inositol |
− | ** ( | + | ** GlcN-Ins |
− | ** ( | + | ** 1-(2-amino-2-deoxy-α-D-glucopyranoside)-1D-myo-inositol |
+ | ** 1-O-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol | ||
+ | ** glucosaminyl-inositol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN1G-121]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878468 46878468] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58886 58886] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15658 C15658] |
− | {{#set: common name= | + | * HMDB : HMDB11668 |
− | {{#set: molecular weight= | + | {{#set: smiles=C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=HEPUIGACZYVUCD-LFIKJOHQSA-O}} |
− | + | {{#set: common name=1-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol}} | |
− | {{#set: consumed | + | {{#set: molecular weight=342.322 }} |
+ | {{#set: common name=6-(α-D-glucosaminyl)-1D-myo-inositol|GlcN-Ins|1-(2-amino-2-deoxy-α-D-glucopyranoside)-1D-myo-inositol|1-O-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol|glucosaminyl-inositol}} | ||
+ | {{#set: consumed by=RXN1G-121}} |
Revision as of 21:31, 17 March 2018
Contents
Metabolite CPD1G-0
- smiles:
- C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
- inchi key:
- InChIKey=HEPUIGACZYVUCD-LFIKJOHQSA-O
- common name:
- 1-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol
- molecular weight:
- 342.322
- Synonym(s):
- 6-(α-D-glucosaminyl)-1D-myo-inositol
- GlcN-Ins
- 1-(2-amino-2-deoxy-α-D-glucopyranoside)-1D-myo-inositol
- 1-O-(2-amino-2-deoxy-α-D-glucopyranosyl)-1D-myo-inositol
- glucosaminyl-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)" cannot be used as a page name in this wiki.